* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034140 |
| English Synonyms: | SYNTHON-LAB SL034140 |
| MDL Number.: | MFCD04530140 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)/N=C\2/NC(=O)/C(=C\c3ccc(o3)c4cccc(c4)Cl)/S2 |
| InChi: | InChI=1S/C21H15ClN2O2S/c1-13-5-7-16(8-6-13)23-21-24-20(25)19(27-21)12-17-9-10-18(26-17)14-3-2-4-15(22)11-14/h2-12H,1H3,(H,23,24,25)/b19-12+ |
| InChiKey: | InChIKey=JNSGUJLZQTZVGY-XDHOZWIPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.