* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031669 |
English Synonyms: | SYNTHON-LAB SL031669 |
MDL Number.: | MFCD04530702 |
H bond acceptor: | 10 |
H bond donor: | 1 |
Smile: | CCOc1cc(cc(c1OC(=O)C)[N+](=O)[O-])/C=C\2/C(=O)N/C(=N/C(=O)C)/S2 |
InChi: | InChI=1S/C16H15N3O7S/c1-4-25-12-6-10(5-11(19(23)24)14(12)26-9(3)21)7-13-15(22)18-16(27-13)17-8(2)20/h5-7H,4H2,1-3H3,(H,17,18,20,22)/b13-7- |
InChiKey: | InChIKey=VEEGJCYWUFBGBT-QPEQYQDCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.