* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL023284 |
English Synonyms: | SYNTHON-LAB SL023284 |
MDL Number.: | MFCD04531064 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | Cc1ccc(cc1)NC(=O)CN2C(=O)/C(=C/c3ccc(cc3)O)/NC2=O |
InChi: | InChI=1S/C19H17N3O4/c1-12-2-6-14(7-3-12)20-17(24)11-22-18(25)16(21-19(22)26)10-13-4-8-15(23)9-5-13/h2-10,23H,11H2,1H3,(H,20,24)(H,21,26)/b16-10- |
InChiKey: | InChIKey=HAVVUJSTHSRKDL-YBEGLDIGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.