* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034305 |
| English Synonyms: | SYNTHON-LAB SL034305 |
| MDL Number.: | MFCD04531262 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)CNC(=O)/C(=C/c2cn(c3c2cccc3)Cc4cccc(c4)[N+](=O)[O-])/C#N |
| InChi: | InChI=1S/C27H22N4O4/c1-35-24-11-9-19(10-12-24)16-29-27(32)21(15-28)14-22-18-30(26-8-3-2-7-25(22)26)17-20-5-4-6-23(13-20)31(33)34/h2-14,18H,16-17H2,1H3,(H,29,32)/b21-14+ |
| InChiKey: | InChIKey=JQXDGBLJSNDECV-KGENOOAVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.