* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL029533 |
| English Synonyms: | SYNTHON-LAB SL029533 |
| MDL Number.: | MFCD04531462 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)c(c[nH]2)CCNC(=O)/C(=C\c3ccc(c(c3)I)OCc4ccc(cc4)C(=O)O)/C#N |
| InChi: | InChI=1S/C28H22IN3O4/c29-24-14-19(7-10-26(24)36-17-18-5-8-20(9-6-18)28(34)35)13-22(15-30)27(33)31-12-11-21-16-32-25-4-2-1-3-23(21)25/h1-10,13-14,16,32H,11-12,17H2,(H,31,33)(H,34,35)/b22-13- |
| InChiKey: | InChIKey=JOEXTSZDHISHEN-XKZIYDEJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.