* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031766 |
English Synonyms: | SYNTHON-LAB SL031766 |
MDL Number.: | MFCD04548698 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)NC(=O)/C(=C/c2ccc(o2)c3ccc(c(c3)Cl)C(=O)O)/C#N |
InChi: | InChI=1S/C21H13ClN2O4/c22-18-11-13(6-8-17(18)21(26)27)19-9-7-16(28-19)10-14(12-23)20(25)24-15-4-2-1-3-5-15/h1-11H,(H,24,25)(H,26,27)/b14-10+ |
InChiKey: | InChIKey=NLYWAVIBQPRHNL-GXDHUFHOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.