* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL022884 |
| English Synonyms: | SYNTHON-LAB SL022884 |
| MDL Number.: | MFCD04550797 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1cc(ccc1c2ccc(o2)/C=C\3/C(=O)N(C(=O)N3)c4cccc(c4)Cl)C(=O)O |
| InChi: | InChI=1S/C22H15ClN2O5/c1-12-9-13(21(27)28)5-7-17(12)19-8-6-16(30-19)11-18-20(26)25(22(29)24-18)15-4-2-3-14(23)10-15/h2-11H,1H3,(H,24,29)(H,27,28)/b18-11- |
| InChiKey: | InChIKey=KZQIMKSYYSWQBO-WQRHYEAKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.