* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL032653 |
| English Synonyms: | SYNTHON-LAB SL032653 |
| MDL Number.: | MFCD04551134 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)NC(=O)CN2C(=O)/C(=C\c3cc(n(c3C)c4cc(cc(c4)C)C)C)/NC2=O |
| InChi: | InChI=1S/C27H28N4O3/c1-16-6-8-22(9-7-16)28-25(32)15-30-26(33)24(29-27(30)34)14-21-13-19(4)31(20(21)5)23-11-17(2)10-18(3)12-23/h6-14H,15H2,1-5H3,(H,28,32)(H,29,34)/b24-14+ |
| InChiKey: | InChIKey=BQZFWNQRUAYYQH-ZVHZXABRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.