* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031928 |
| English Synonyms: | SYNTHON-LAB SL031928 |
| MDL Number.: | MFCD04551318 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | Cc1cc(cc(c1)N2C(=O)/C(=C/c3cn(c4c3cccc4)CC(=O)N5CCOCC5)/C(=O)NC2=O)C |
| InChi: | InChI=1S/C27H26N4O5/c1-17-11-18(2)13-20(12-17)31-26(34)22(25(33)28-27(31)35)14-19-15-30(23-6-4-3-5-21(19)23)16-24(32)29-7-9-36-10-8-29/h3-6,11-15H,7-10,16H2,1-2H3,(H,28,33,35)/b22-14+ |
| InChiKey: | InChIKey=UCBSLJSCYRBCMV-HYARGMPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.