* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL027097 |
| English Synonyms: | SYNTHON-LAB SL027097 |
| MDL Number.: | MFCD04551841 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOc1ccc(cc1)N2C(=O)/C(=C\c3cccn3c4ccc(cc4)Cl)/C(=O)NC2=S |
| InChi: | InChI=1S/C23H18ClN3O3S/c1-2-30-19-11-9-17(10-12-19)27-22(29)20(21(28)25-23(27)31)14-18-4-3-13-26(18)16-7-5-15(24)6-8-16/h3-14H,2H2,1H3,(H,25,28,31)/b20-14- |
| InChiKey: | InChIKey=NDIDJYXJNALHID-ZHZULCJRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.