* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035280 |
English Synonyms: | SYNTHON-LAB SL035280 |
MDL Number.: | MFCD04553050 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)N2C(=O)/C(=C\c3ccc(cc3)Sc4ccc(cc4)Cl)/C(=O)NC2=O |
InChi: | InChI=1S/C24H17ClN2O4S/c1-31-18-8-6-17(7-9-18)27-23(29)21(22(28)26-24(27)30)14-15-2-10-19(11-3-15)32-20-12-4-16(25)5-13-20/h2-14H,1H3,(H,26,28,30)/b21-14- |
InChiKey: | InChIKey=PGDUVCCFUSYIGX-STZFKDTASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.