* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL095176 |
| English Synonyms: | SYNTHON-LAB SL095176 |
| MDL Number.: | MFCD04553080 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C1CCN(CC1)C2=NC(=O)/C(=C/c3ccc(c(c3)OC)OCc4ccc(cc4)C)/S2 |
| InChi: | InChI=1S/C27H30N2O5S/c1-4-33-26(31)21-11-13-29(14-12-21)27-28-25(30)24(35-27)16-20-9-10-22(23(15-20)32-3)34-17-19-7-5-18(2)6-8-19/h5-10,15-16,21H,4,11-14,17H2,1-3H3/b24-16- |
| InChiKey: | InChIKey=CMROAWZLZXEHNQ-JLPGSUDCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.