* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL032632 |
English Synonyms: | SYNTHON-LAB SL032632 |
MDL Number.: | MFCD04553314 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cc(ccc1CN2C(=O)/C(=C\c3ccc(cc3)OCC(=O)N)/NC2=O)F |
InChi: | InChI=1S/C19H16FN3O4/c20-14-5-1-13(2-6-14)10-23-18(25)16(22-19(23)26)9-12-3-7-15(8-4-12)27-11-17(21)24/h1-9H,10-11H2,(H2,21,24)(H,22,26)/b16-9+ |
InChiKey: | InChIKey=DHJAMYKQLPFWRU-CXUHLZMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.