* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053495 |
| English Synonyms: | SYNTHON-LAB SL053495 |
| MDL Number.: | MFCD04554558 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C=CCOc1ccc(cc1)NC(=O)C(=O)N/N=C/c2cccc3c2cccc3 |
| InChi: | InChI=1S/C22H19N3O3/c1-2-14-28-19-12-10-18(11-13-19)24-21(26)22(27)25-23-15-17-8-5-7-16-6-3-4-9-20(16)17/h2-13,15H,1,14H2,(H,24,26)(H,25,27)/b23-15+ |
| InChiKey: | InChIKey=NWAYPUABJRULIB-HZHRSRAPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.