* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL022869 |
| English Synonyms: | SYNTHON-LAB SL022869 |
| MDL Number.: | MFCD04554874 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)COc2ccc(cc2OC)/C=C\3/C(=O)N(C(=O)N3)c4cccc(c4)Cl |
| InChi: | InChI=1S/C25H21ClN2O4/c1-16-6-8-17(9-7-16)15-32-22-11-10-18(13-23(22)31-2)12-21-24(29)28(25(30)27-21)20-5-3-4-19(26)14-20/h3-14H,15H2,1-2H3,(H,27,30)/b21-12- |
| InChiKey: | InChIKey=PKFPJGIGHNEYQD-MTJSOVHGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.