* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL022867 |
| English Synonyms: | SYNTHON-LAB SL022867 |
| MDL Number.: | MFCD04555364 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCOc1cc(ccc1OCc2ccc(cc2)C(=O)O)/C=C\3/C(=O)N(C(=O)N3)c4cccc(c4)Cl |
| InChi: | InChI=1S/C26H21ClN2O6/c1-2-34-23-13-17(8-11-22(23)35-15-16-6-9-18(10-7-16)25(31)32)12-21-24(30)29(26(33)28-21)20-5-3-4-19(27)14-20/h3-14H,2,15H2,1H3,(H,28,33)(H,31,32)/b21-12- |
| InChiKey: | InChIKey=JCBTWQGMFUTFQP-MTJSOVHGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.