* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL095152 |
| English Synonyms: | SYNTHON-LAB SL095152 |
| MDL Number.: | MFCD04555663 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cc1)COc2ccc(cc2)/C=C\3/C(=O)N=C(S3)N4CCN(CC4)Cc5ccccc5 |
| InChi: | InChI=1S/C29H29N3O2S/c1-22-7-9-25(10-8-22)21-34-26-13-11-23(12-14-26)19-27-28(33)30-29(35-27)32-17-15-31(16-18-32)20-24-5-3-2-4-6-24/h2-14,19H,15-18,20-21H2,1H3/b27-19- |
| InChiKey: | InChIKey=CANMKTBCMZWFHT-DIBXZPPDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.