* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033121 |
English Synonyms: | SYNTHON-LAB SL033121 |
MDL Number.: | MFCD04556591 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cc(ccc1c2ccc(o2)/C=C/3\C(=O)N(C(=O)N3)Cc4ccccc4)C(=O)O |
InChi: | InChI=1S/C23H18N2O5/c1-14-11-16(22(27)28)7-9-18(14)20-10-8-17(30-20)12-19-21(26)25(23(29)24-19)13-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,24,29)(H,27,28)/b19-12+ |
InChiKey: | InChIKey=WVQTWOONUJFXFP-XDHOZWIPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.