* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031050 |
| English Synonyms: | SYNTHON-LAB SL031050 |
| MDL Number.: | MFCD04556714 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CCOc1cc(cc(c1OCc2ccccc2C#N)Cl)/C=N/Nc3ccc(cc3)[N+](=O)[O-] |
| InChi: | InChI=1S/C23H19ClN4O4/c1-2-31-22-12-16(14-26-27-19-7-9-20(10-8-19)28(29)30)11-21(24)23(22)32-15-18-6-4-3-5-17(18)13-25/h3-12,14,27H,2,15H2,1H3/b26-14+ |
| InChiKey: | InChIKey=DOEFTDJCGZMGMH-VULFUBBASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.