* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL053212 |
English Synonyms: | SYNTHON-LAB SL053212 |
MDL Number.: | MFCD04570839 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CC(C)CNC(=O)C(=O)N/N=C/c1ccc(c(c1)OC)OCC(=O)Nc2ccc(cc2)Br |
InChi: | InChI=1S/C22H25BrN4O5/c1-14(2)11-24-21(29)22(30)27-25-12-15-4-9-18(19(10-15)31-3)32-13-20(28)26-17-7-5-16(23)6-8-17/h4-10,12,14H,11,13H2,1-3H3,(H,24,29)(H,26,28)(H,27,30)/b25-12+ |
InChiKey: | InChIKey=UCYVGRIYABLVGW-BRJLIKDPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.