* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL030959 |
English Synonyms: | SYNTHON-LAB SL030959 |
MDL Number.: | MFCD04570878 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1ccc(c(c1)/C=C/2\C(=O)N(C(=O)N2)Cc3ccc(cc3)Br)OC |
InChi: | InChI=1S/C19H17BrN2O4/c1-25-15-7-8-17(26-2)13(9-15)10-16-18(23)22(19(24)21-16)11-12-3-5-14(20)6-4-12/h3-10H,11H2,1-2H3,(H,21,24)/b16-10+ |
InChiKey: | InChIKey=NOVWVPOPZWJMAV-MHWRWJLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.