* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL029531 |
English Synonyms: | SYNTHON-LAB SL029531 |
MDL Number.: | MFCD04571358 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)/C=C(/C#N)\C(=O)NCCc2c[nH]c3c2cccc3)OCc4ccc(cc4)C(=O)O |
InChi: | InChI=1S/C28H23N3O4/c29-16-23(27(32)30-14-13-22-17-31-25-7-3-2-6-24(22)25)15-21-5-1-4-8-26(21)35-18-19-9-11-20(12-10-19)28(33)34/h1-12,15,17,31H,13-14,18H2,(H,30,32)(H,33,34)/b23-15- |
InChiKey: | InChIKey=QWGRJHGTVOSTOG-HAHDFKILSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.