* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL024587 |
English Synonyms: | SYNTHON-LAB SL024587 |
MDL Number.: | MFCD04571627 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | c1cc(ccc1[C@]23C[C@@H]4C[C@H](C2)C[C@@H](C4)C3)N5C(=O)/C(=C\c6ccc(o6)N7CCOCC7)/C(=O)NC5=O |
InChi: | InChI=1S/C29H31N3O5/c33-26-24(14-23-5-6-25(37-23)31-7-9-36-10-8-31)27(34)32(28(35)30-26)22-3-1-21(2-4-22)29-15-18-11-19(16-29)13-20(12-18)17-29/h1-6,14,18-20H,7-13,15-17H2,(H,30,33,35)/b24-14-/t18-,19+,20-,29- |
InChiKey: | InChIKey=YXJWOBSKUYZHLV-ADZCRSAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.