* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL052871 |
| English Synonyms: | SYNTHON-LAB SL052871 |
| MDL Number.: | MFCD04572395 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCCCNC(=O)C(=O)Nc1ccc(cc1)C |
| InChi: | InChI=1S/C14H20N2O2/c1-3-4-5-10-15-13(17)14(18)16-12-8-6-11(2)7-9-12/h6-9H,3-5,10H2,1-2H3,(H,15,17)(H,16,18) |
| InChiKey: | InChIKey=SILPCOVLEYVWAK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.