* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034165 |
English Synonyms: | SYNTHON-LAB SL034165 |
MDL Number.: | MFCD04575547 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CCN\1C(=O)/C(=C\c2ccc(o2)c3ccc(cc3)C#N)/S/C1=N\c4ccc(cc4)N5CCOCC5 |
InChi: | InChI=1S/C27H24N4O3S/c1-2-31-26(32)25(17-23-11-12-24(34-23)20-5-3-19(18-28)4-6-20)35-27(31)29-21-7-9-22(10-8-21)30-13-15-33-16-14-30/h3-12,17H,2,13-16H2,1H3/b25-17+,29-27- |
InChiKey: | InChIKey=YVCHDNNHVYFMMO-XJBRANNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.