* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL093093 |
English Synonyms: | SYNTHON-LAB SL093093 |
MDL Number.: | MFCD04575953 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCc1ccc(cc1)/C=C\2/C(=O)N(C(=S)S2)CCc3ccccc3 |
InChi: | InChI=1S/C20H19NOS2/c1-2-15-8-10-17(11-9-15)14-18-19(22)21(20(23)24-18)13-12-16-6-4-3-5-7-16/h3-11,14H,2,12-13H2,1H3/b18-14- |
InChiKey: | InChIKey=MWQSFBASIMTTQA-JXAWBTAJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.