* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL050306 |
| English Synonyms: | SYNTHON-LAB SL050306 |
| MDL Number.: | MFCD04596758 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccccc1N2CC(CC2=O)C(=O)N/N=C/c3ccc(cc3)Br |
| InChi: | InChI=1S/C19H18BrN3O2/c1-13-4-2-3-5-17(13)23-12-15(10-18(23)24)19(25)22-21-11-14-6-8-16(20)9-7-14/h2-9,11,15H,10,12H2,1H3,(H,22,25)/b21-11+ |
| InChiKey: | InChIKey=RWWDCCRIEFEQLT-SRZZPIQSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.