* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL032725 |
| English Synonyms: | SYNTHON-LAB SL032725 |
| MDL Number.: | MFCD04596913 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1c(c2ccccc2n1C)/C=C/3\C(=O)NC(=O)N3 |
| InChi: | InChI=1S/C14H13N3O2/c1-8-10(7-11-13(18)16-14(19)15-11)9-5-3-4-6-12(9)17(8)2/h3-7H,1-2H3,(H2,15,16,18,19)/b11-7+ |
| InChiKey: | InChIKey=IFIXUEROBQQWRK-YRNVUSSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.