* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL032694 |
| English Synonyms: | SYNTHON-LAB SL032694 |
| MDL Number.: | MFCD04597059 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)NC(=O)CN2C(=O)/C(=C\c3cc4c(cc3Br)OCO4)/NC2=O |
| InChi: | InChI=1S/C20H16BrN3O5/c1-11-2-4-13(5-3-11)22-18(25)9-24-19(26)15(23-20(24)27)6-12-7-16-17(8-14(12)21)29-10-28-16/h2-8H,9-10H2,1H3,(H,22,25)(H,23,27)/b15-6+ |
| InChiKey: | InChIKey=HNAUPGCATBYWEV-GIDUJCDVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.