* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031862 |
| English Synonyms: | SYNTHON-LAB SL031862 |
| MDL Number.: | MFCD04597568 |
| H bond acceptor: | 11 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)N2C(=O)C(C(=O)NC2=O)C(c3ccncc3)C4C(=O)NC(=O)N(C4=O)c5ccc(cc5)C |
| InChi: | InChI=1S/C28H23N5O6/c1-15-3-7-18(8-4-15)32-25(36)21(23(34)30-27(32)38)20(17-11-13-29-14-12-17)22-24(35)31-28(39)33(26(22)37)19-9-5-16(2)6-10-19/h3-14,20-22H,1-2H3,(H,30,34,38)(H,31,35,39) |
| InChiKey: | InChIKey=VHHSZSIZEYUING-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.