* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL050320 |
| English Synonyms: | SYNTHON-LAB SL050320 |
| MDL Number.: | MFCD04597857 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)N2CC(CC2=O)C(=O)N/N=C\c3ccco3 |
| InChi: | InChI=1S/C16H15N3O3/c20-15-9-12(11-19(15)13-5-2-1-3-6-13)16(21)18-17-10-14-7-4-8-22-14/h1-8,10,12H,9,11H2,(H,18,21)/b17-10- |
| InChiKey: | InChIKey=OYNCGJBHRQUBMO-YVLHZVERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.