* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL085553 |
English Synonyms: | SYNTHON-LAB SL085553 |
MDL Number.: | MFCD04617169 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCOc1ccc(cc1)/C=C/2\C(=O)N(C(=S)S2)c3cccc(c3)C(=O)O |
InChi: | InChI=1S/C20H17NO4S2/c1-2-10-25-16-8-6-13(7-9-16)11-17-18(22)21(20(26)27-17)15-5-3-4-14(12-15)19(23)24/h3-9,11-12H,2,10H2,1H3,(H,23,24)/b17-11+ |
InChiKey: | InChIKey=TWIBSQIGQWSIFV-GZTJUZNOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.