* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL070359 |
| English Synonyms: | SYNTHON-LAB SL070359 |
| MDL Number.: | MFCD04952176 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2ccc(nc2c(c1)O)/C=C/c3ccsc3 |
| InChi: | InChI=1S/C15H11NOS/c17-14-3-1-2-12-5-7-13(16-15(12)14)6-4-11-8-9-18-10-11/h1-10,17H/b6-4+ |
| InChiKey: | InChIKey=LPVYCNOMMFYQJY-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.