* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL038297 |
English Synonyms: | SYNTHON-LAB SL038297 |
MDL Number.: | MFCD04966509 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)/C=C/C=C(\C#N)/C(=O)Nc2ccc(cc2)O |
InChi: | InChI=1S/C18H14N2O2/c19-13-15(8-4-7-14-5-2-1-3-6-14)18(22)20-16-9-11-17(21)12-10-16/h1-12,21H,(H,20,22)/b7-4+,15-8+ |
InChiKey: | InChIKey=RFHURXKZTSMTBQ-DUEVJXGLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.