* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TIMTEC-BB SBB031713 |
English Synonyms: | TIMTEC-BB SBB031713 |
MDL Number.: | MFCD04969057 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1/C=C/2\C(=O)N=C(S2)S)[N+](=O)[O-])Cl |
InChi: | InChI=1S/C10H5ClN2O3S2/c11-6-2-1-5(3-7(6)13(15)16)4-8-9(14)12-10(17)18-8/h1-4H,(H,12,14,17)/b8-4+ |
InChiKey: | InChIKey=NBYJQRLZAULILW-XBXARRHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.