* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HANSA DW241 |
| English Synonyms: | HANSA DW241 |
| MDL Number.: | MFCD05025522 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CS(=O)(=O)c1nc(cc(n1)C(F)(F)F)c2ccccc2 |
| InChi: | InChI=1S/C12H9F3N2O2S/c1-20(18,19)11-16-9(8-5-3-2-4-6-8)7-10(17-11)12(13,14)15/h2-7H,1H3 |
| InChiKey: | InChIKey=HZSJKGMPEXGXBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.