* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL089533 |
| English Synonyms: | SYNTHON-LAB SL089533 |
| MDL Number.: | MFCD05111132 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | Cc1ccccc1C(=O)NCCc2nnc(n2CC=C)SCC(=O)Nc3ccc(cc3)[N+](=O)[O-] |
| InChi: | InChI=1S/C23H24N6O4S/c1-3-14-28-20(12-13-24-22(31)19-7-5-4-6-16(19)2)26-27-23(28)34-15-21(30)25-17-8-10-18(11-9-17)29(32)33/h3-11H,1,12-15H2,2H3,(H,24,31)(H,25,30) |
| InChiKey: | InChIKey=RARADIWKHJWQSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.