* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL038155 |
| English Synonyms: | SYNTHON-LAB SL038155 |
| MDL Number.: | MFCD05134403 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)C(=O)N/N=C/c2ccc(c(c2)Br)OCC(=O)O)n3cccc3 |
| InChi: | InChI=1S/C20H16BrN3O4/c21-16-11-14(7-8-18(16)28-13-19(25)26)12-22-23-20(27)15-5-1-2-6-17(15)24-9-3-4-10-24/h1-12H,13H2,(H,23,27)(H,25,26)/b22-12+ |
| InChiKey: | InChIKey=ROSRQXCYUULJTJ-WSDLNYQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.