* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037718 |
| English Synonyms: | SYNTHON-LAB SL037718 |
| MDL Number.: | MFCD05149514 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | Cc1cccc(c1)NC(=O)CN2C(=O)/C(=C\c3cc(n(c3C)c4ccc(cc4)O)C)/NC2=O |
| InChi: | InChI=1S/C25H24N4O4/c1-15-5-4-6-19(11-15)26-23(31)14-28-24(32)22(27-25(28)33)13-18-12-16(2)29(17(18)3)20-7-9-21(30)10-8-20/h4-13,30H,14H2,1-3H3,(H,26,31)(H,27,33)/b22-13+ |
| InChiKey: | InChIKey=ZCVYTPPVONWIIH-LPYMAVHISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.