* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL037680 |
English Synonyms: | SYNTHON-LAB SL037680 |
MDL Number.: | MFCD05149524 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1cc(ccc1/C=C/2\C(=O)N(C(=O)N2)Cc3ccccc3)N4CCCC4 |
InChi: | InChI=1S/C22H23N3O3/c1-28-20-14-18(24-11-5-6-12-24)10-9-17(20)13-19-21(26)25(22(27)23-19)15-16-7-3-2-4-8-16/h2-4,7-10,13-14H,5-6,11-12,15H2,1H3,(H,23,27)/b19-13+ |
InChiKey: | InChIKey=TVAVZNBEUFSOKY-CPNJWEJPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.