* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037630 |
| English Synonyms: | SYNTHON-LAB SL037630 |
| MDL Number.: | MFCD05149538 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCN1C(=O)/C(=C\c2cc(c(cc2Br)O)OC)/NC1=O |
| InChi: | InChI=1S/C13H13BrN2O4/c1-3-16-12(18)9(15-13(16)19)4-7-5-11(20-2)10(17)6-8(7)14/h4-6,17H,3H2,1-2H3,(H,15,19)/b9-4+ |
| InChiKey: | InChIKey=OIEDBGRGEYTHHS-RUDMXATFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.