* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037216 |
| English Synonyms: | SYNTHON-LAB SL037216 |
| MDL Number.: | MFCD05149549 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(c1)N2C(=O)/C(=C/c3cc(n(c3C)c4cccc(c4C)C(=O)O)C)/C(=O)NC2=S)C |
| InChi: | InChI=1S/C27H25N3O4S/c1-14-9-10-15(2)23(11-14)30-25(32)21(24(31)28-27(30)35)13-19-12-16(3)29(18(19)5)22-8-6-7-20(17(22)4)26(33)34/h6-13H,1-5H3,(H,33,34)(H,28,31,35)/b21-13+ |
| InChiKey: | InChIKey=ZSZKMFOQMZPJMR-FYJGNVAPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.