* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037213 |
| English Synonyms: | SYNTHON-LAB SL037213 |
| MDL Number.: | MFCD05149553 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(c1)N2C(=O)/C(=C/c3ccc(o3)c4ccccc4C(=O)O)/C(=O)NC2=S)C |
| InChi: | InChI=1S/C24H18N2O5S/c1-13-7-8-14(2)19(11-13)26-22(28)18(21(27)25-24(26)32)12-15-9-10-20(31-15)16-5-3-4-6-17(16)23(29)30/h3-12H,1-2H3,(H,29,30)(H,25,27,32)/b18-12+ |
| InChiKey: | InChIKey=JKFWNYPDDJLBLQ-LDADJPATSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.