* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL038429 |
| English Synonyms: | SYNTHON-LAB SL038429 |
| MDL Number.: | MFCD05149923 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCOc1cc(ccc1OCC#N)C=C2C(=O)NC(=O)NC2=O |
| InChi: | InChI=1S/C15H13N3O5/c1-2-22-12-8-9(3-4-11(12)23-6-5-16)7-10-13(19)17-15(21)18-14(10)20/h3-4,7-8H,2,6H2,1H3,(H2,17,18,19,20,21) |
| InChiKey: | InChIKey=KYWPQKFFMFTQSA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.