* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-BR-5-(2-CL-5-NITROPHENYL)-2-PH-1,10B-DIHYDROPYRAZOLO(1,5-C)(1,3)BENZOXAZINE |
| English Synonyms: | 9-BR-5-(2-CL-5-NITROPHENYL)-2-PH-1,10B-DIHYDROPYRAZOLO(1,5-C)(1,3)BENZOXAZINE |
| MDL Number.: | MFCD05151574 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)C2=NN3C(C2)c4cc(ccc4OC3c5cc(ccc5Cl)[N+](=O)[O-])Br |
| InChi: | InChI=1S/C22H15BrClN3O3/c23-14-6-9-21-17(10-14)20-12-19(13-4-2-1-3-5-13)25-26(20)22(30-21)16-11-15(27(28)29)7-8-18(16)24/h1-11,20,22H,12H2 |
| InChiKey: | InChIKey=ITPXWRLJBZFUBN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.