* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BR-5-(2-CL-6-F-PH)-2-PHENYL-1,10B-DIHYDROPYRAZOLO(1,5-C)(1,3)BENZOXAZINE |
English Synonyms: | 9-BR-5-(2-CL-6-F-PH)-2-PHENYL-1,10B-DIHYDROPYRAZOLO(1,5-C)(1,3)BENZOXAZINE |
MDL Number.: | MFCD05151575 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C2=NN3C(C2)c4cc(ccc4OC3c5c(cccc5Cl)F)Br |
InChi: | InChI=1S/C22H15BrClFN2O/c23-14-9-10-20-15(11-14)19-12-18(13-5-2-1-3-6-13)26-27(19)22(28-20)21-16(24)7-4-8-17(21)25/h1-11,19,22H,12H2 |
InChiKey: | InChIKey=JLCZBAKAFNOVRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.