* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DMU-135 |
CAS: | 209158-91-8 |
English Synonyms: | DMU-135 |
MDL Number.: | MFCD05364213 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | COc1cc(cc(c1OC)OC)C(=O)/C=C/c2ccc3c(c2)OCO3 |
InChi: | InChI=1S/C19H18O6/c1-21-17-9-13(10-18(22-2)19(17)23-3)14(20)6-4-12-5-7-15-16(8-12)25-11-24-15/h4-10H,11H2,1-3H3/b6-4+ |
InChiKey: | InChIKey=JGVTZQYRMQWZQO-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.