* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-ETHYL-3-(ETHYLTHIO)-9H-[1,2,4]TRIAZOLO[4,3-A]BENZIMIDAZOLE |
| English Synonyms: | 9-ETHYL-3-(ETHYLTHIO)-9H-[1,2,4]TRIAZOLO[4,3-A]BENZIMIDAZOLE |
| MDL Number.: | MFCD05838261 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCn1c2ccccc2n3c1nnc3SCC |
| InChi: | InChI=1S/C12H14N4S/c1-3-15-9-7-5-6-8-10(9)16-11(15)13-14-12(16)17-4-2/h5-8H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=MHAVDKYGKICZGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.