* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-[1-L (E),3-L (Z)-NONADIENYLOXY]-8(E)-NONENOIC ACID |
| English Synonyms: | 9-[1-L (E),3-L (Z)-NONADIENYLOXY]-8(E)-NONENOIC ACID ; COLNELEIC ACID |
| MDL Number.: | MFCD05864089 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCC/C=C\C=C\O/C=C/CCCCCCC(=O)O |
| InChi: | InChI=1S/C18H30O3/c1-2-3-4-5-7-10-13-16-21-17-14-11-8-6-9-12-15-18(19)20/h7,10,13-14,16-17H,2-6,8-9,11-12,15H2,1H3,(H,19,20)/b10-7-,16-13+,17-14+ |
| InChiKey: | InChIKey=HHZKKFXQEIBVEV-CXXUKANQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.