* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025675 |
| English Synonyms: | VITAS-BB TBB025675 |
| MDL Number.: | MFCD05989447 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | ClC1=C(SC2=C1C=CC(Cl)=C2)C(=O)NNC(=S)NC1=C(Cl)C(Cl)=CC=C1 |
| InChi: | InChI=1S/C16H9Cl4N3OS2/c17-7-4-5-8-11(6-7)26-14(12(8)19)15(24)22-23-16(25)21-10-3-1-2-9(18)13(10)20/h1-6H,(H,22,24)(H2,21,23,25) |
| InChiKey: | InChIKey=ZJJOBTZJGIVRJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.